![1-(4-Nitrophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine (CAS: 65973-73-1) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0680897.png "1-(4-Nitrophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine chemical structure")
1-(4-Nitrophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
Catalog No: FT-0680897
CAS No: 65973-73-1
- Chemical Name: 1-(4-Nitrophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine
- Molecular Formula: C11H8N6O2
- Molecular Weight: 256.22
- InChI Key: NFVAFEQWWNNKLX-UHFFFAOYSA-N
- InChI: InChI=1S/C11H8N6O2/c12-10-9-5-15-16(11(9)14-6-13-10)7-1-3-8(4-2-7)17(18)19/h1-6H,(H2,12,13,14)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 256.22000 |
| Density: | 1.69g/cm3 |
| CAS: | 65973-73-1 |
| Bolling_Point: | 448.3ºC at 760 mmHg |
| Product_Name: | 1-(4-Nitrophenyl)-1H-pyrazolo[3,4-d]pyrimidin-4-amine |
| Melting_Point: | N/A |
| Flash_Point: | 224.9ºC |
| MF: | C11H8N6O2 |
| Density: | 1.69g/cm3 |
|---|---|
| LogP: | 2.41030 |
| Flash_Point: | 224.9ºC |
| Refractive_Index: | 1.827 |
| FW: | 256.22000 |
| PSA: | 115.44000 |
| MF: | C11H8N6O2 |
| Bolling_Point: | 448.3ºC at 760 mmHg |
| Exact_Mass: | 256.07100 |
| Symbol: | GHS07 |
|---|---|
| Safety_Statements: | H302 |
| HS_Code: | 2933990090 |
| RIDADR: | NONH for all modes of transport |
![2-[4-[(dimethylamino)methyl]phenyl]acetic acid (CAS: 99985-52-1) - Related Chemical Product](/static/img/prod_pic/FT-0737063.png "2-[4-[(dimethylamino)methyl]phenyl]acetic acid chemical structure")
![2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol (CAS: 99982-60-2) - Related Chemical Product](/static/img/prod_pic/FT-0749988.png "2-[2-hydroxyethyl-[(4-nitrophenyl)methyl]amino]ethanol chemical structure")
